About 1-methoxypropan-2-yl hypofluorite
1-methoxypropan-2-yl hypofluorite (PubChem CID 174616565) has the molecular formula C4H9FO2
and a molecular weight of 108.11 g/mol. Its IUPAC name is 1-methoxypropan-2-yl hypofluorite.
Molecular Properties
| Compound Name | 1-methoxypropan-2-yl hypofluorite |
| PubChem CID | 174616565 |
| Molecular Formula | C4H9FO2 |
| Molecular Weight | 108.11 g/mol |
| Exact Mass | 108.06 |
| IUPAC Name | 1-methoxypropan-2-yl hypofluorite |
| SMILES | COCC(C)OF |
| InChI | InChI=1S/C4H9FO2/c1-4(7-5)3-6-2/h4H,3H2,1-2H3 |
| InChIKey | WEMVWJHIMXJIHO-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.11 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methoxypropan-2-yl hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypropan-2-yl hypofluorite?
The IUPAC name of 1-methoxypropan-2-yl hypofluorite (CID 174616565) is 1-methoxypropan-2-yl hypofluorite.
What is the SMILES notation for 1-methoxypropan-2-yl hypofluorite?
The canonical SMILES for 1-methoxypropan-2-yl hypofluorite is COCC(C)OF.
What is the InChIKey of 1-methoxypropan-2-yl hypofluorite?
The InChIKey is WEMVWJHIMXJIHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9FO2/c1-4(7-5)3-6-2/h4H,3H2,1-2H3.
What are the key properties of 1-methoxypropan-2-yl hypofluorite?
1-methoxypropan-2-yl hypofluorite has a molecular weight of 108.11 g/mol, XLogP of 0.92, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropan-2-yl hypofluorite is sourced from PubChem (CID 174616565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).