C13H14BrF3O2 — CID 174617251
2-[4-(1-bromoethyl)phenyl]-5,5,5-trifluoropentanoic acid (PubChem CID 174617251) has the molecular formula C13H14BrF3O2 and a molecular weight of 339.15 g/mol. Its IUPAC name is 2-[4-(1-bromoethyl)phenyl]-5,5,5-trifluoropentanoic acid.
| Compound Name | 2-[4-(1-bromoethyl)phenyl]-5,5,5-trifluoropentanoic acid |
|---|---|
| PubChem CID | 174617251 |
| Molecular Formula | C13H14BrF3O2 |
| Molecular Weight | 339.15 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 2-[4-(1-bromoethyl)phenyl]-5,5,5-trifluoropentanoic acid |
| SMILES | CC(Br)c1ccc(C(CCC(F)(F)F)C(=O)O)cc1 |
| InChI | InChI=1S/C13H14BrF3O2/c1-8(14)9-2-4-10(5-3-9)11(12(18)19)6-7-13(15,16)17/h2-5,8,11H,6-7H2,1H3,(H,18,19) |
| InChIKey | ZJLYUGOPXJCPIK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.15 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|