C25H33N9O4S — CID 174617578
[4-[[2-(1H-indazol-4-yl)-9-(2-methoxyethyl)-6-morpholin-4-ylpurin-8-yl]methyl]piperazin-1-yl]methanesulfinic acid (PubChem CID 174617578) has the molecular formula C25H33N9O4S and a molecular weight of 555.67 g/mol. Its IUPAC name is [4-[[2-(1H-indazol-4-yl)-9-(2-methoxyethyl)-6-morpholin-4-ylpurin-8-yl]methyl]piperazin-1-yl]methanesulfinic acid.
| Compound Name | [4-[[2-(1H-indazol-4-yl)-9-(2-methoxyethyl)-6-morpholin-4-ylpurin-8-yl]methyl]piperazin-1-yl]methanesulfinic acid |
|---|---|
| PubChem CID | 174617578 |
| Molecular Formula | C25H33N9O4S |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.24 |
| IUPAC Name | [4-[[2-(1H-indazol-4-yl)-9-(2-methoxyethyl)-6-morpholin-4-ylpurin-8-yl]methyl]piperazin-1-yl]methanesulfinic acid |
| SMILES | COCCn1c(CN2CCN(CS(=O)O)CC2)nc2c(N3CCOCC3)nc(-c3cccc4[nH]ncc34)nc21 |
| InChI | InChI=1S/C25H33N9O4S/c1-37-12-11-34-21(16-31-5-7-32(8-6-31)17-39(35)36)27-22-24(33-9-13-38-14-10-33)28-23(29-25(22)34)18-3-2-4-20-19(18)15-26-30-20/h2-4,15H,5-14,16-17H2,1H3,(H,26,30)(H,35,36) |
| InChIKey | VNZZVTAVIFFNEB-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 137.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|