C19H23BrN2O3 — CID 174617924
1-(4-bromophenyl)-4-(cyclohexylamino)-2-ethyl-5-oxo-2H-pyrrole-3-carboxylic acid (PubChem CID 174617924) has the molecular formula C19H23BrN2O3 and a molecular weight of 407.31 g/mol. Its IUPAC name is 1-(4-bromophenyl)-4-(cyclohexylamino)-2-ethyl-5-oxo-2H-pyrrole-3-carboxylic acid.
| Compound Name | 1-(4-bromophenyl)-4-(cyclohexylamino)-2-ethyl-5-oxo-2H-pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 174617924 |
| Molecular Formula | C19H23BrN2O3 |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 1-(4-bromophenyl)-4-(cyclohexylamino)-2-ethyl-5-oxo-2H-pyrrole-3-carboxylic acid |
| SMILES | CCC1C(C(=O)O)=C(NC2CCCCC2)C(=O)N1c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H23BrN2O3/c1-2-15-16(19(24)25)17(21-13-6-4-3-5-7-13)18(23)22(15)14-10-8-12(20)9-11-14/h8-11,13,15,21H,2-7H2,1H3,(H,24,25) |
| InChIKey | GTDYBKSFYACWSJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |