About cyclopenta-1,3-dien-1-yl(trimethyl)azanium;platinum
cyclopenta-1,3-dien-1-yl(trimethyl)azanium;platinum (PubChem CID 174617970) has the molecular formula C8H14NPt+
and a molecular weight of 319.29 g/mol. Its IUPAC name is cyclopenta-1,3-dien-1-yl(trimethyl)azanium;platinum.
Molecular Properties
| Compound Name | cyclopenta-1,3-dien-1-yl(trimethyl)azanium;platinum |
| PubChem CID | 174617970 |
| Molecular Formula | C8H14NPt+ |
| Molecular Weight | 319.29 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | cyclopenta-1,3-dien-1-yl(trimethyl)azanium;platinum |
| SMILES | C[N+](C)(C)C1=CC=CC1.[Pt] |
| InChI | InChI=1S/C8H14N.Pt/c1-9(2,3)8-6-4-5-7-8;/h4-6H,7H2,1-3H3;/q+1; |
| InChIKey | JPRLJMZSAPKZPM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.29 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,3-dien-1-yl(trimethyl)azanium;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-dien-1-yl(trimethyl)azanium;platinum?
The IUPAC name of cyclopenta-1,3-dien-1-yl(trimethyl)azanium;platinum (CID 174617970) is cyclopenta-1,3-dien-1-yl(trimethyl)azanium;platinum.
What is the SMILES notation for cyclopenta-1,3-dien-1-yl(trimethyl)azanium;platinum?
The canonical SMILES for cyclopenta-1,3-dien-1-yl(trimethyl)azanium;platinum is C[N+](C)(C)C1=CC=CC1.[Pt].
What is the InChIKey of cyclopenta-1,3-dien-1-yl(trimethyl)azanium;platinum?
The InChIKey is JPRLJMZSAPKZPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N.Pt/c1-9(2,3)8-6-4-5-7-8;/h4-6H,7H2,1-3H3;/q+1;.
What are the key properties of cyclopenta-1,3-dien-1-yl(trimethyl)azanium;platinum?
cyclopenta-1,3-dien-1-yl(trimethyl)azanium;platinum has a molecular weight of 319.29 g/mol, XLogP of 1.53, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-dien-1-yl(trimethyl)azanium;platinum is sourced from PubChem (CID 174617970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).