About 5-methyl-3-(3,3,3-trifluoropropoxy)-1H-pyrazole
5-methyl-3-(3,3,3-trifluoropropoxy)-1H-pyrazole (PubChem CID 174618182) has the molecular formula C7H9F3N2O
and a molecular weight of 194.16 g/mol. Its IUPAC name is 5-methyl-3-(3,3,3-trifluoropropoxy)-1H-pyrazole.
Molecular Properties
| Compound Name | 5-methyl-3-(3,3,3-trifluoropropoxy)-1H-pyrazole |
| PubChem CID | 174618182 |
| Molecular Formula | C7H9F3N2O |
| Molecular Weight | 194.16 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 5-methyl-3-(3,3,3-trifluoropropoxy)-1H-pyrazole |
| SMILES | Cc1cc(OCCC(F)(F)F)n[nH]1 |
| InChI | InChI=1S/C7H9F3N2O/c1-5-4-6(12-11-5)13-3-2-7(8,9)10/h4H,2-3H2,1H3,(H,11,12) |
| InChIKey | WPOVIDAQABUWER-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.16 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-3-(3,3,3-trifluoropropoxy)-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-(3,3,3-trifluoropropoxy)-1H-pyrazole?
The IUPAC name of 5-methyl-3-(3,3,3-trifluoropropoxy)-1H-pyrazole (CID 174618182) is 5-methyl-3-(3,3,3-trifluoropropoxy)-1H-pyrazole.
What is the SMILES notation for 5-methyl-3-(3,3,3-trifluoropropoxy)-1H-pyrazole?
The canonical SMILES for 5-methyl-3-(3,3,3-trifluoropropoxy)-1H-pyrazole is Cc1cc(OCCC(F)(F)F)n[nH]1.
What is the InChIKey of 5-methyl-3-(3,3,3-trifluoropropoxy)-1H-pyrazole?
The InChIKey is WPOVIDAQABUWER-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F3N2O/c1-5-4-6(12-11-5)13-3-2-7(8,9)10/h4H,2-3H2,1H3,(H,11,12).
What are the key properties of 5-methyl-3-(3,3,3-trifluoropropoxy)-1H-pyrazole?
5-methyl-3-(3,3,3-trifluoropropoxy)-1H-pyrazole has a molecular weight of 194.16 g/mol, XLogP of 2.05, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-(3,3,3-trifluoropropoxy)-1H-pyrazole is sourced from PubChem (CID 174618182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).