C25H47F6N4O6P — CID 174618419
2-[3-[2-hydroxy-2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxyethyl]imidazol-3-ium-1-yl]-1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxyethanol hexafluorophosphate (PubChem CID 174618419) has the molecular formula C25H47F6N4O6P and a molecular weight of 644.64 g/mol. Its IUPAC name is 2-[3-[2-hydroxy-2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxyethyl]imidazol-3-ium-1-yl]-1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxyethanol hexafluorophosphate.
| Compound Name | 2-[3-[2-hydroxy-2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxyethyl]imidazol-3-ium-1-yl]-1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxyethanol hexafluorophosphate |
|---|---|
| PubChem CID | 174618419 |
| Molecular Formula | C25H47F6N4O6P |
| Molecular Weight | 644.64 g/mol |
| Exact Mass | 644.31 |
| IUPAC Name | 2-[3-[2-hydroxy-2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxyethyl]imidazol-3-ium-1-yl]-1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxyethanol hexafluorophosphate |
| SMILES | CC1(C)CC(OC(O)Cn2cc[n+](CC(O)OC3CC(C)(C)N(O)C(C)(C)C3)c2)CC(C)(C)N1O.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C25H47N4O6.F6P/c1-22(2)11-18(12-23(3,4)28(22)32)34-20(30)15-26-9-10-27(17-26)16-21(31)35-19-13-24(5,6)29(33)25(7,8)14-19;1-7(2,3,4,5)6/h9-10,17-21,30-33H,11-16H2,1-8H3;/q+1;-1 |
| InChIKey | WFRICMXBNGDUTB-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.64 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|