C14H20N2O2 — CID 174618434
4,4-dimethyl-1-[(2-nitrophenyl)methyl]piperidine (PubChem CID 174618434) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 4,4-dimethyl-1-[(2-nitrophenyl)methyl]piperidine.
| Compound Name | 4,4-dimethyl-1-[(2-nitrophenyl)methyl]piperidine |
|---|---|
| PubChem CID | 174618434 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 4,4-dimethyl-1-[(2-nitrophenyl)methyl]piperidine |
| SMILES | CC1(C)CCN(Cc2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C14H20N2O2/c1-14(2)7-9-15(10-8-14)11-12-5-3-4-6-13(12)16(17)18/h3-6H,7-11H2,1-2H3 |
| InChIKey | GAOAMKWEMWZYMR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|