About 1-methyl-2,7-dihydropurine
1-methyl-2,7-dihydropurine (PubChem CID 174619335) has the molecular formula C6H8N4
and a molecular weight of 136.16 g/mol. Its IUPAC name is 1-methyl-2,7-dihydropurine.
Molecular Properties
| Compound Name | 1-methyl-2,7-dihydropurine |
| PubChem CID | 174619335 |
| Molecular Formula | C6H8N4 |
| Molecular Weight | 136.16 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | 1-methyl-2,7-dihydropurine |
| SMILES | CN1C=c2[nH]cnc2=NC1 |
| InChI | InChI=1S/C6H8N4/c1-10-2-5-6(9-4-10)8-3-7-5/h2-3H,4H2,1H3,(H,7,8,9) |
| InChIKey | GLONQJYCJWZQKX-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 44.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.16 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-2,7-dihydropurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2,7-dihydropurine?
The IUPAC name of 1-methyl-2,7-dihydropurine (CID 174619335) is 1-methyl-2,7-dihydropurine.
What is the SMILES notation for 1-methyl-2,7-dihydropurine?
The canonical SMILES for 1-methyl-2,7-dihydropurine is CN1C=c2[nH]cnc2=NC1.
What is the InChIKey of 1-methyl-2,7-dihydropurine?
The InChIKey is GLONQJYCJWZQKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4/c1-10-2-5-6(9-4-10)8-3-7-5/h2-3H,4H2,1H3,(H,7,8,9).
What are the key properties of 1-methyl-2,7-dihydropurine?
1-methyl-2,7-dihydropurine has a molecular weight of 136.16 g/mol, XLogP of -1.33, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2,7-dihydropurine is sourced from PubChem (CID 174619335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).