About 4-(1-butylpiperidin-4-yl)-2-methylpyrrolo[3,4-c]quinoline;methanol
4-(1-butylpiperidin-4-yl)-2-methylpyrrolo[3,4-c]quinoline;methanol (PubChem CID 174619541) has the molecular formula C22H31N3O
and a molecular weight of 353.51 g/mol. Its IUPAC name is 4-(1-butylpiperidin-4-yl)-2-methylpyrrolo[3,4-c]quinoline;methanol.
Molecular Properties
| Compound Name | 4-(1-butylpiperidin-4-yl)-2-methylpyrrolo[3,4-c]quinoline;methanol |
| PubChem CID | 174619541 |
| Molecular Formula | C22H31N3O |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | 4-(1-butylpiperidin-4-yl)-2-methylpyrrolo[3,4-c]quinoline;methanol |
| SMILES | CCCCN1CCC(c2nc3ccccc3c3cn(C)cc23)CC1.CO |
| InChI | InChI=1S/C21H27N3.CH4O/c1-3-4-11-24-12-9-16(10-13-24)21-19-15-23(2)14-18(19)17-7-5-6-8-20(17)22-21;1-2/h5-8,14-16H,3-4,9-13H2,1-2H3;2H,1H3 |
| InChIKey | DJOKZFICFSSIOE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1-butylpiperidin-4-yl)-2-methylpyrrolo[3,4-c]quinoline;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-butylpiperidin-4-yl)-2-methylpyrrolo[3,4-c]quinoline;methanol?
The IUPAC name of 4-(1-butylpiperidin-4-yl)-2-methylpyrrolo[3,4-c]quinoline;methanol (CID 174619541) is 4-(1-butylpiperidin-4-yl)-2-methylpyrrolo[3,4-c]quinoline;methanol.
What is the SMILES notation for 4-(1-butylpiperidin-4-yl)-2-methylpyrrolo[3,4-c]quinoline;methanol?
The canonical SMILES for 4-(1-butylpiperidin-4-yl)-2-methylpyrrolo[3,4-c]quinoline;methanol is CCCCN1CCC(c2nc3ccccc3c3cn(C)cc23)CC1.CO.
What is the InChIKey of 4-(1-butylpiperidin-4-yl)-2-methylpyrrolo[3,4-c]quinoline;methanol?
The InChIKey is DJOKZFICFSSIOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27N3.CH4O/c1-3-4-11-24-12-9-16(10-13-24)21-19-15-23(2)14-18(19)17-7-5-6-8-20(17)22-21;1-2/h5-8,14-16H,3-4,9-13H2,1-2H3;2H,1H3.
What are the key properties of 4-(1-butylpiperidin-4-yl)-2-methylpyrrolo[3,4-c]quinoline;methanol?
4-(1-butylpiperidin-4-yl)-2-methylpyrrolo[3,4-c]quinoline;methanol has a molecular weight of 353.51 g/mol, XLogP of 4.31, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-butylpiperidin-4-yl)-2-methylpyrrolo[3,4-c]quinoline;methanol is sourced from PubChem (CID 174619541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).