About 9-[4-(1,3-thiazol-2-yl)phenyl]purine-2,6-diamine
9-[4-(1,3-thiazol-2-yl)phenyl]purine-2,6-diamine (PubChem CID 174619624) has the molecular formula C14H11N7S
and a molecular weight of 309.36 g/mol. Its IUPAC name is 9-[4-(1,3-thiazol-2-yl)phenyl]purine-2,6-diamine.
Molecular Properties
| Compound Name | 9-[4-(1,3-thiazol-2-yl)phenyl]purine-2,6-diamine |
| PubChem CID | 174619624 |
| Molecular Formula | C14H11N7S |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 9-[4-(1,3-thiazol-2-yl)phenyl]purine-2,6-diamine |
| SMILES | Nc1nc(N)c2ncn(-c3ccc(-c4nccs4)cc3)c2n1 |
| InChI | InChI=1S/C14H11N7S/c15-11-10-12(20-14(16)19-11)21(7-18-10)9-3-1-8(2-4-9)13-17-5-6-22-13/h1-7H,(H4,15,16,19,20) |
| InChIKey | CSTHXTYODDPCFX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 108.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 9-[4-(1,3-thiazol-2-yl)phenyl]purine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[4-(1,3-thiazol-2-yl)phenyl]purine-2,6-diamine?
The IUPAC name of 9-[4-(1,3-thiazol-2-yl)phenyl]purine-2,6-diamine (CID 174619624) is 9-[4-(1,3-thiazol-2-yl)phenyl]purine-2,6-diamine.
What is the SMILES notation for 9-[4-(1,3-thiazol-2-yl)phenyl]purine-2,6-diamine?
The canonical SMILES for 9-[4-(1,3-thiazol-2-yl)phenyl]purine-2,6-diamine is Nc1nc(N)c2ncn(-c3ccc(-c4nccs4)cc3)c2n1.
What is the InChIKey of 9-[4-(1,3-thiazol-2-yl)phenyl]purine-2,6-diamine?
The InChIKey is CSTHXTYODDPCFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N7S/c15-11-10-12(20-14(16)19-11)21(7-18-10)9-3-1-8(2-4-9)13-17-5-6-22-13/h1-7H,(H4,15,16,19,20).
What are the key properties of 9-[4-(1,3-thiazol-2-yl)phenyl]purine-2,6-diamine?
9-[4-(1,3-thiazol-2-yl)phenyl]purine-2,6-diamine has a molecular weight of 309.36 g/mol, XLogP of 2.10, 2 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[4-(1,3-thiazol-2-yl)phenyl]purine-2,6-diamine is sourced from PubChem (CID 174619624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).