C22H25NO8 — CID 174619766
[4-[(3S,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]-3-hydroxy-4,4-diphenylbutan-2-yl] nitrate (PubChem CID 174619766) has the molecular formula C22H25NO8 and a molecular weight of 431.44 g/mol. Its IUPAC name is [4-[(3S,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]-3-hydroxy-4,4-diphenylbutan-2-yl] nitrate.
| Compound Name | [4-[(3S,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]-3-hydroxy-4,4-diphenylbutan-2-yl] nitrate |
|---|---|
| PubChem CID | 174619766 |
| Molecular Formula | C22H25NO8 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | [4-[(3S,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]-3-hydroxy-4,4-diphenylbutan-2-yl] nitrate |
| SMILES | CC(O[N+](=O)[O-])C(O)C(c1ccccc1)(c1ccccc1)[C@]1(O)CO[C@@H]2[C@@H](O)CO[C@@H]21 |
| InChI | InChI=1S/C22H25NO8/c1-14(31-23(27)28)19(25)22(15-8-4-2-5-9-15,16-10-6-3-7-11-16)21(26)13-30-18-17(24)12-29-20(18)21/h2-11,14,17-20,24-26H,12-13H2,1H3/t14?,17-,18+,19?,20-,21-/m0/s1 |
| InChIKey | GVHBWCGGKIEHRT-RUPYEJBSSA-N |
| XLogP | 0.82 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|