About 2-(cyclopenta-1,3-dien-1-ylmethyl)oxirane;phenol
2-(cyclopenta-1,3-dien-1-ylmethyl)oxirane;phenol (PubChem CID 174620575) has the molecular formula C14H16O2
and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-(cyclopenta-1,3-dien-1-ylmethyl)oxirane;phenol.
Molecular Properties
| Compound Name | 2-(cyclopenta-1,3-dien-1-ylmethyl)oxirane;phenol |
| PubChem CID | 174620575 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 2-(cyclopenta-1,3-dien-1-ylmethyl)oxirane;phenol |
| SMILES | C1=CCC(CC2CO2)=C1.Oc1ccccc1 |
| InChI | InChI=1S/C8H10O.C6H6O/c1-2-4-7(3-1)5-8-6-9-8;7-6-4-2-1-3-5-6/h1-3,8H,4-6H2;1-5,7H |
| InChIKey | XEJYWKVMCVCDOD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(cyclopenta-1,3-dien-1-ylmethyl)oxirane;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclopenta-1,3-dien-1-ylmethyl)oxirane;phenol?
The IUPAC name of 2-(cyclopenta-1,3-dien-1-ylmethyl)oxirane;phenol (CID 174620575) is 2-(cyclopenta-1,3-dien-1-ylmethyl)oxirane;phenol.
What is the SMILES notation for 2-(cyclopenta-1,3-dien-1-ylmethyl)oxirane;phenol?
The canonical SMILES for 2-(cyclopenta-1,3-dien-1-ylmethyl)oxirane;phenol is C1=CCC(CC2CO2)=C1.Oc1ccccc1.
What is the InChIKey of 2-(cyclopenta-1,3-dien-1-ylmethyl)oxirane;phenol?
The InChIKey is XEJYWKVMCVCDOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O.C6H6O/c1-2-4-7(3-1)5-8-6-9-8;7-6-4-2-1-3-5-6/h1-3,8H,4-6H2;1-5,7H.
What are the key properties of 2-(cyclopenta-1,3-dien-1-ylmethyl)oxirane;phenol?
2-(cyclopenta-1,3-dien-1-ylmethyl)oxirane;phenol has a molecular weight of 216.28 g/mol, XLogP of 3.05, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopenta-1,3-dien-1-ylmethyl)oxirane;phenol is sourced from PubChem (CID 174620575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).