About 2-(4-methyl-3-prop-2-enyl-2H-1,3-thiazol-5-yl)ethanol;hydrobromide
2-(4-methyl-3-prop-2-enyl-2H-1,3-thiazol-5-yl)ethanol;hydrobromide (PubChem CID 174621034) has the molecular formula C9H16BrNOS
and a molecular weight of 266.20 g/mol. Its IUPAC name is 2-(4-methyl-3-prop-2-enyl-2H-1,3-thiazol-5-yl)ethanol;hydrobromide.
Molecular Properties
| Compound Name | 2-(4-methyl-3-prop-2-enyl-2H-1,3-thiazol-5-yl)ethanol;hydrobromide |
| PubChem CID | 174621034 |
| Molecular Formula | C9H16BrNOS |
| Molecular Weight | 266.20 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 2-(4-methyl-3-prop-2-enyl-2H-1,3-thiazol-5-yl)ethanol;hydrobromide |
| SMILES | Br.C=CCN1CSC(CCO)=C1C |
| InChI | InChI=1S/C9H15NOS.BrH/c1-3-5-10-7-12-9(4-6-11)8(10)2;/h3,11H,1,4-7H2,2H3;1H |
| InChIKey | MLQUXOXFKGVNKJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.20 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methyl-3-prop-2-enyl-2H-1,3-thiazol-5-yl)ethanol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-3-prop-2-enyl-2H-1,3-thiazol-5-yl)ethanol;hydrobromide?
The IUPAC name of 2-(4-methyl-3-prop-2-enyl-2H-1,3-thiazol-5-yl)ethanol;hydrobromide (CID 174621034) is 2-(4-methyl-3-prop-2-enyl-2H-1,3-thiazol-5-yl)ethanol;hydrobromide.
What is the SMILES notation for 2-(4-methyl-3-prop-2-enyl-2H-1,3-thiazol-5-yl)ethanol;hydrobromide?
The canonical SMILES for 2-(4-methyl-3-prop-2-enyl-2H-1,3-thiazol-5-yl)ethanol;hydrobromide is Br.C=CCN1CSC(CCO)=C1C.
What is the InChIKey of 2-(4-methyl-3-prop-2-enyl-2H-1,3-thiazol-5-yl)ethanol;hydrobromide?
The InChIKey is MLQUXOXFKGVNKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NOS.BrH/c1-3-5-10-7-12-9(4-6-11)8(10)2;/h3,11H,1,4-7H2,2H3;1H.
What are the key properties of 2-(4-methyl-3-prop-2-enyl-2H-1,3-thiazol-5-yl)ethanol;hydrobromide?
2-(4-methyl-3-prop-2-enyl-2H-1,3-thiazol-5-yl)ethanol;hydrobromide has a molecular weight of 266.20 g/mol, XLogP of 2.37, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-3-prop-2-enyl-2H-1,3-thiazol-5-yl)ethanol;hydrobromide is sourced from PubChem (CID 174621034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).