About (2-carboxyanilino)methyl sulfite
(2-carboxyanilino)methyl sulfite (PubChem CID 174621214) has the molecular formula C8H8NO5S-
and a molecular weight of 230.22 g/mol. Its IUPAC name is (2-carboxyanilino)methyl sulfite.
Molecular Properties
| Compound Name | (2-carboxyanilino)methyl sulfite |
| PubChem CID | 174621214 |
| Molecular Formula | C8H8NO5S- |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.01 |
| IUPAC Name | (2-carboxyanilino)methyl sulfite |
| SMILES | O=C(O)c1ccccc1NCOS(=O)[O-] |
| InChI | InChI=1S/C8H9NO5S/c10-8(11)6-3-1-2-4-7(6)9-5-14-15(12)13/h1-4,9H,5H2,(H,10,11)(H,12,13)/p-1 |
| InChIKey | RNJLNJXUXJWSDR-UHFFFAOYSA-M |
| XLogP | 0.56 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze (2-carboxyanilino)methyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-carboxyanilino)methyl sulfite?
The IUPAC name of (2-carboxyanilino)methyl sulfite (CID 174621214) is (2-carboxyanilino)methyl sulfite.
What is the SMILES notation for (2-carboxyanilino)methyl sulfite?
The canonical SMILES for (2-carboxyanilino)methyl sulfite is O=C(O)c1ccccc1NCOS(=O)[O-].
What is the InChIKey of (2-carboxyanilino)methyl sulfite?
The InChIKey is RNJLNJXUXJWSDR-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H9NO5S/c10-8(11)6-3-1-2-4-7(6)9-5-14-15(12)13/h1-4,9H,5H2,(H,10,11)(H,12,13)/p-1.
What are the key properties of (2-carboxyanilino)methyl sulfite?
(2-carboxyanilino)methyl sulfite has a molecular weight of 230.22 g/mol, XLogP of 0.56, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-carboxyanilino)methyl sulfite is sourced from PubChem (CID 174621214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).