About 4-(oxiran-2-ylmethyl)-7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid
4-(oxiran-2-ylmethyl)-7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid (PubChem CID 174621467) has the molecular formula C11H12O6
and a molecular weight of 240.21 g/mol. Its IUPAC name is 4-(oxiran-2-ylmethyl)-7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid.
Molecular Properties
| Compound Name | 4-(oxiran-2-ylmethyl)-7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid |
| PubChem CID | 174621467 |
| Molecular Formula | C11H12O6 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 4-(oxiran-2-ylmethyl)-7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid |
| SMILES | O=C(O)C1C=C2OC2CC1(CC1CO1)C(=O)O |
| InChI | InChI=1S/C11H12O6/c12-9(13)6-1-7-8(17-7)3-11(6,10(14)15)2-5-4-16-5/h1,5-6,8H,2-4H2,(H,12,13)(H,14,15) |
| InChIKey | RCEJFSOPSPBSJG-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-(oxiran-2-ylmethyl)-7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(oxiran-2-ylmethyl)-7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid?
The IUPAC name of 4-(oxiran-2-ylmethyl)-7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid (CID 174621467) is 4-(oxiran-2-ylmethyl)-7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid.
What is the SMILES notation for 4-(oxiran-2-ylmethyl)-7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid?
The canonical SMILES for 4-(oxiran-2-ylmethyl)-7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid is O=C(O)C1C=C2OC2CC1(CC1CO1)C(=O)O.
What is the InChIKey of 4-(oxiran-2-ylmethyl)-7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid?
The InChIKey is RCEJFSOPSPBSJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O6/c12-9(13)6-1-7-8(17-7)3-11(6,10(14)15)2-5-4-16-5/h1,5-6,8H,2-4H2,(H,12,13)(H,14,15).
What are the key properties of 4-(oxiran-2-ylmethyl)-7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid?
4-(oxiran-2-ylmethyl)-7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid has a molecular weight of 240.21 g/mol, XLogP of 0.23, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(oxiran-2-ylmethyl)-7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylic acid is sourced from PubChem (CID 174621467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).