C27H53NO5 — CID 174622015
2-(2-methylpiperidin-4-yl)decanedioic acid;2,6,6-trimethyloctan-1-ol (PubChem CID 174622015) has the molecular formula C27H53NO5 and a molecular weight of 471.72 g/mol. Its IUPAC name is 2-(2-methylpiperidin-4-yl)decanedioic acid;2,6,6-trimethyloctan-1-ol.
| Compound Name | 2-(2-methylpiperidin-4-yl)decanedioic acid;2,6,6-trimethyloctan-1-ol |
|---|---|
| PubChem CID | 174622015 |
| Molecular Formula | C27H53NO5 |
| Molecular Weight | 471.72 g/mol |
| Exact Mass | 471.39 |
| IUPAC Name | 2-(2-methylpiperidin-4-yl)decanedioic acid;2,6,6-trimethyloctan-1-ol |
| SMILES | CC1CC(C(CCCCCCCC(=O)O)C(=O)O)CCN1.CCC(C)(C)CCCC(C)CO |
| InChI | InChI=1S/C16H29NO4.C11H24O/c1-12-11-13(9-10-17-12)14(16(20)21)7-5-3-2-4-6-8-15(18)19;1-5-11(3,4)8-6-7-10(2)9-12/h12-14,17H,2-11H2,1H3,(H,18,19)(H,20,21);10,12H,5-9H2,1-4H3 |
| InChIKey | WZEIFYLUEPFFCZ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.72 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|