About 1H-indole-3-carbaldehyde;quinoline
1H-indole-3-carbaldehyde;quinoline (PubChem CID 174622034) has the molecular formula C18H14N2O
and a molecular weight of 274.32 g/mol. Its IUPAC name is 1H-indole-3-carbaldehyde;quinoline.
Molecular Properties
| Compound Name | 1H-indole-3-carbaldehyde;quinoline |
| PubChem CID | 174622034 |
| Molecular Formula | C18H14N2O |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 1H-indole-3-carbaldehyde;quinoline |
| SMILES | O=Cc1c[nH]c2ccccc12.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7NO.C9H7N/c11-6-7-5-10-9-4-2-1-3-8(7)9;1-2-6-9-8(4-1)5-3-7-10-9/h1-6,10H;1-7H |
| InChIKey | YZXINASDMKVMJU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1H-indole-3-carbaldehyde;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole-3-carbaldehyde;quinoline?
The IUPAC name of 1H-indole-3-carbaldehyde;quinoline (CID 174622034) is 1H-indole-3-carbaldehyde;quinoline.
What is the SMILES notation for 1H-indole-3-carbaldehyde;quinoline?
The canonical SMILES for 1H-indole-3-carbaldehyde;quinoline is O=Cc1c[nH]c2ccccc12.c1ccc2ncccc2c1.
What is the InChIKey of 1H-indole-3-carbaldehyde;quinoline?
The InChIKey is YZXINASDMKVMJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO.C9H7N/c11-6-7-5-10-9-4-2-1-3-8(7)9;1-2-6-9-8(4-1)5-3-7-10-9/h1-6,10H;1-7H.
What are the key properties of 1H-indole-3-carbaldehyde;quinoline?
1H-indole-3-carbaldehyde;quinoline has a molecular weight of 274.32 g/mol, XLogP of 4.22, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole-3-carbaldehyde;quinoline is sourced from PubChem (CID 174622034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).