C16H15NO2 — CID 174622317
11-oxa-8-azatetracyclo[7.5.0.02,7.010,12]tetradeca-1(9),2,4,6,10(12),13-hexaene;oxolane (PubChem CID 174622317) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 11-oxa-8-azatetracyclo[7.5.0.02,7.010,12]tetradeca-1(9),2,4,6,10(12),13-hexaene;oxolane.
| Compound Name | 11-oxa-8-azatetracyclo[7.5.0.02,7.010,12]tetradeca-1(9),2,4,6,10(12),13-hexaene;oxolane |
|---|---|
| PubChem CID | 174622317 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 11-oxa-8-azatetracyclo[7.5.0.02,7.010,12]tetradeca-1(9),2,4,6,10(12),13-hexaene;oxolane |
| SMILES | C1CCOC1.c1ccc2c(c1)[nH]c1c3c(ccc12)O3 |
| InChI | InChI=1S/C12H7NO.C4H8O/c1-2-4-9-7(3-1)8-5-6-10-12(14-10)11(8)13-9;1-2-4-5-3-1/h1-6,13H;1-4H2 |
| InChIKey | QDKVRNIHHFIPSD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 37.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|