About (3-acetamido-2-hydroxyphenyl)arsonic acid;propyl 3-(2-oxocyclopentyl)propanoate
(3-acetamido-2-hydroxyphenyl)arsonic acid;propyl 3-(2-oxocyclopentyl)propanoate (PubChem CID 174622348) has the molecular formula C19H28AsNO8
and a molecular weight of 473.35 g/mol. Its IUPAC name is (3-acetamido-2-hydroxyphenyl)arsonic acid;propyl 3-(2-oxocyclopentyl)propanoate.
Molecular Properties
| Compound Name | (3-acetamido-2-hydroxyphenyl)arsonic acid;propyl 3-(2-oxocyclopentyl)propanoate |
| PubChem CID | 174622348 |
| Molecular Formula | C19H28AsNO8 |
| Molecular Weight | 473.35 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | (3-acetamido-2-hydroxyphenyl)arsonic acid;propyl 3-(2-oxocyclopentyl)propanoate |
| SMILES | CC(=O)Nc1cccc([As](=O)(O)O)c1O.CCCOC(=O)CCC1CCCC1=O |
| InChI | InChI=1S/C11H18O3.C8H10AsNO5/c1-2-8-14-11(13)7-6-9-4-3-5-10(9)12;1-5(11)10-7-4-2-3-6(8(7)12)9(13,14)15/h9H,2-8H2,1H3;2-4,12H,1H3,(H,10,11)(H2,13,14,15) |
| InChIKey | WMSYWVOGHNKPCQ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 150.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 473.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3-acetamido-2-hydroxyphenyl)arsonic acid;propyl 3-(2-oxocyclopentyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-acetamido-2-hydroxyphenyl)arsonic acid;propyl 3-(2-oxocyclopentyl)propanoate?
The IUPAC name of (3-acetamido-2-hydroxyphenyl)arsonic acid;propyl 3-(2-oxocyclopentyl)propanoate (CID 174622348) is (3-acetamido-2-hydroxyphenyl)arsonic acid;propyl 3-(2-oxocyclopentyl)propanoate.
What is the SMILES notation for (3-acetamido-2-hydroxyphenyl)arsonic acid;propyl 3-(2-oxocyclopentyl)propanoate?
The canonical SMILES for (3-acetamido-2-hydroxyphenyl)arsonic acid;propyl 3-(2-oxocyclopentyl)propanoate is CC(=O)Nc1cccc([As](=O)(O)O)c1O.CCCOC(=O)CCC1CCCC1=O.
What is the InChIKey of (3-acetamido-2-hydroxyphenyl)arsonic acid;propyl 3-(2-oxocyclopentyl)propanoate?
The InChIKey is WMSYWVOGHNKPCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O3.C8H10AsNO5/c1-2-8-14-11(13)7-6-9-4-3-5-10(9)12;1-5(11)10-7-4-2-3-6(8(7)12)9(13,14)15/h9H,2-8H2,1H3;2-4,12H,1H3,(H,10,11)(H2,13,14,15).
What are the key properties of (3-acetamido-2-hydroxyphenyl)arsonic acid;propyl 3-(2-oxocyclopentyl)propanoate?
(3-acetamido-2-hydroxyphenyl)arsonic acid;propyl 3-(2-oxocyclopentyl)propanoate has a molecular weight of 473.35 g/mol, XLogP of 1.00, 7 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-acetamido-2-hydroxyphenyl)arsonic acid;propyl 3-(2-oxocyclopentyl)propanoate is sourced from PubChem (CID 174622348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).