C25H27NO — CID 174623162
(2,6-dimethyl-1,2,3,4-tetrahydrochrysen-1-yl)methanol;1H-pyrrole (PubChem CID 174623162) has the molecular formula C25H27NO and a molecular weight of 357.50 g/mol. Its IUPAC name is (2,6-dimethyl-1,2,3,4-tetrahydrochrysen-1-yl)methanol;1H-pyrrole.
| Compound Name | (2,6-dimethyl-1,2,3,4-tetrahydrochrysen-1-yl)methanol;1H-pyrrole |
|---|---|
| PubChem CID | 174623162 |
| Molecular Formula | C25H27NO |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | (2,6-dimethyl-1,2,3,4-tetrahydrochrysen-1-yl)methanol;1H-pyrrole |
| SMILES | Cc1cc2c3c(ccc2c2ccccc12)C(CO)C(C)CC3.c1cc[nH]c1 |
| InChI | InChI=1S/C21H22O.C4H5N/c1-13-7-8-17-19(21(13)12-22)10-9-18-16-6-4-3-5-15(16)14(2)11-20(17)18;1-2-4-5-3-1/h3-6,9-11,13,21-22H,7-8,12H2,1-2H3;1-5H |
| InChIKey | QJXLEBHUEISNEO-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|