C16H21N6O3S- — CID 174624118
[1-[(2S)-3-cyclopentyl-1-[(5-methylpyrazin-2-yl)amino]-1-oxopropan-2-yl]-1,2,4-triazol-3-yl]methanesulfinate (PubChem CID 174624118) has the molecular formula C16H21N6O3S- and a molecular weight of 377.45 g/mol. Its IUPAC name is [1-[(2S)-3-cyclopentyl-1-[(5-methylpyrazin-2-yl)amino]-1-oxopropan-2-yl]-1,2,4-triazol-3-yl]methanesulfinate.
| Compound Name | [1-[(2S)-3-cyclopentyl-1-[(5-methylpyrazin-2-yl)amino]-1-oxopropan-2-yl]-1,2,4-triazol-3-yl]methanesulfinate |
|---|---|
| PubChem CID | 174624118 |
| Molecular Formula | C16H21N6O3S- |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | [1-[(2S)-3-cyclopentyl-1-[(5-methylpyrazin-2-yl)amino]-1-oxopropan-2-yl]-1,2,4-triazol-3-yl]methanesulfinate |
| SMILES | Cc1cnc(NC(=O)[C@H](CC2CCCC2)n2cnc(CS(=O)[O-])n2)cn1 |
| InChI | InChI=1S/C16H22N6O3S/c1-11-7-18-14(8-17-11)20-16(23)13(6-12-4-2-3-5-12)22-10-19-15(21-22)9-26(24)25/h7-8,10,12-13H,2-6,9H2,1H3,(H,24,25)(H,18,20,23)/p-1/t13-/m0/s1 |
| InChIKey | ZECUXCFHCIIVQL-ZDUSSCGKSA-M |
| XLogP | 1.52 |
| TPSA | 125.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|