C35H36Br2N12O — CID 174624201
2,4-bis[4-[4-(3-bromo-2H-pyrazolo[3,4-d]pyrimidin-4-yl)piperazin-1-yl]phenyl]pentan-3-one (PubChem CID 174624201) has the molecular formula C35H36Br2N12O and a molecular weight of 800.56 g/mol. Its IUPAC name is 2,4-bis[4-[4-(3-bromo-2H-pyrazolo[3,4-d]pyrimidin-4-yl)piperazin-1-yl]phenyl]pentan-3-one.
| Compound Name | 2,4-bis[4-[4-(3-bromo-2H-pyrazolo[3,4-d]pyrimidin-4-yl)piperazin-1-yl]phenyl]pentan-3-one |
|---|---|
| PubChem CID | 174624201 |
| Molecular Formula | C35H36Br2N12O |
| Molecular Weight | 800.56 g/mol |
| Exact Mass | 798.15 |
| IUPAC Name | 2,4-bis[4-[4-(3-bromo-2H-pyrazolo[3,4-d]pyrimidin-4-yl)piperazin-1-yl]phenyl]pentan-3-one |
| SMILES | CC(C(=O)C(C)c1ccc(N2CCN(c3ncnc4n[nH]c(Br)c34)CC2)cc1)c1ccc(N2CCN(c3ncnc4n[nH]c(Br)c34)CC2)cc1 |
| InChI | InChI=1S/C35H36Br2N12O/c1-21(23-3-7-25(8-4-23)46-11-15-48(16-12-46)34-27-30(36)42-44-32(27)38-19-40-34)29(50)22(2)24-5-9-26(10-6-24)47-13-17-49(18-14-47)35-28-31(37)43-45-33(28)39-20-41-35/h3-10,19-22H,11-18H2,1-2H3,(H,38,40,42,44)(H,39,41,43,45) |
| InChIKey | CNYGIDSKRAVEBY-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.56 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|