C22H28NO+ — CID 174624390
1-[4-[2-(4-anilino-2-methylcyclopentyl)ethyl]phenyl]ethanone;hydron (PubChem CID 174624390) has the molecular formula C22H28NO+ and a molecular weight of 322.47 g/mol. Its IUPAC name is 1-[4-[2-(4-anilino-2-methylcyclopentyl)ethyl]phenyl]ethanone;hydron.
| Compound Name | 1-[4-[2-(4-anilino-2-methylcyclopentyl)ethyl]phenyl]ethanone;hydron |
|---|---|
| PubChem CID | 174624390 |
| Molecular Formula | C22H28NO+ |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | 1-[4-[2-(4-anilino-2-methylcyclopentyl)ethyl]phenyl]ethanone;hydron |
| SMILES | CC(=O)c1ccc(CCC2CC(Nc3ccccc3)CC2C)cc1.[H+] |
| InChI | InChI=1S/C22H27NO/c1-16-14-22(23-21-6-4-3-5-7-21)15-20(16)13-10-18-8-11-19(12-9-18)17(2)24/h3-9,11-12,16,20,22-23H,10,13-15H2,1-2H3/p+1 |
| InChIKey | HKAKGTVNGVBOOB-UHFFFAOYSA-O |
| XLogP | 5.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |