C10H7F7O2 — CID 174624593
3-fluoro-2-(1,2,3,5,6,7-hexafluoro-2-bicyclo[2.2.1]heptanyl)prop-2-enoic acid (PubChem CID 174624593) has the molecular formula C10H7F7O2 and a molecular weight of 292.15 g/mol. Its IUPAC name is 3-fluoro-2-(1,2,3,5,6,7-hexafluoro-2-bicyclo[2.2.1]heptanyl)prop-2-enoic acid.
| Compound Name | 3-fluoro-2-(1,2,3,5,6,7-hexafluoro-2-bicyclo[2.2.1]heptanyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 174624593 |
| Molecular Formula | C10H7F7O2 |
| Molecular Weight | 292.15 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 3-fluoro-2-(1,2,3,5,6,7-hexafluoro-2-bicyclo[2.2.1]heptanyl)prop-2-enoic acid |
| SMILES | O=C(O)C(=CF)C1(F)C(F)C2C(F)C(F)C1(F)C2F |
| InChI | InChI=1S/C10H7F7O2/c11-1-2(8(18)19)9(16)5(13)3-4(12)7(15)10(9,17)6(3)14/h1,3-7H,(H,18,19) |
| InChIKey | QLDOOAISAFGPLC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.15 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|