C9H18N4S2 — CID 174624657
1-amino-6-hexyl-1,3,5-triazinane-2,4-dithione (PubChem CID 174624657) has the molecular formula C9H18N4S2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 1-amino-6-hexyl-1,3,5-triazinane-2,4-dithione.
| Compound Name | 1-amino-6-hexyl-1,3,5-triazinane-2,4-dithione |
|---|---|
| PubChem CID | 174624657 |
| Molecular Formula | C9H18N4S2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 1-amino-6-hexyl-1,3,5-triazinane-2,4-dithione |
| SMILES | CCCCCCC1NC(=S)NC(=S)N1N |
| InChI | InChI=1S/C9H18N4S2/c1-2-3-4-5-6-7-11-8(14)12-9(15)13(7)10/h7H,2-6,10H2,1H3,(H2,11,12,14,15) |
| InChIKey | CXKDOFLRPAXPQJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|