About 4-aminoadamantan-1-ol;hydrate;hydrochloride
4-aminoadamantan-1-ol;hydrate;hydrochloride (PubChem CID 174624676) has the molecular formula C10H20ClNO2
and a molecular weight of 221.73 g/mol. Its IUPAC name is 4-aminoadamantan-1-ol;hydrate;hydrochloride.
Molecular Properties
| Compound Name | 4-aminoadamantan-1-ol;hydrate;hydrochloride |
| PubChem CID | 174624676 |
| Molecular Formula | C10H20ClNO2 |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 4-aminoadamantan-1-ol;hydrate;hydrochloride |
| SMILES | Cl.NC1C2CC3CC1CC(O)(C3)C2.O |
| InChI | InChI=1S/C10H17NO.ClH.H2O/c11-9-7-1-6-2-8(9)5-10(12,3-6)4-7;;/h6-9,12H,1-5,11H2;1H;1H2 |
| InChIKey | UQSBCHOIXKGNAE-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-aminoadamantan-1-ol;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminoadamantan-1-ol;hydrate;hydrochloride?
The IUPAC name of 4-aminoadamantan-1-ol;hydrate;hydrochloride (CID 174624676) is 4-aminoadamantan-1-ol;hydrate;hydrochloride.
What is the SMILES notation for 4-aminoadamantan-1-ol;hydrate;hydrochloride?
The canonical SMILES for 4-aminoadamantan-1-ol;hydrate;hydrochloride is Cl.NC1C2CC3CC1CC(O)(C3)C2.O.
What is the InChIKey of 4-aminoadamantan-1-ol;hydrate;hydrochloride?
The InChIKey is UQSBCHOIXKGNAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO.ClH.H2O/c11-9-7-1-6-2-8(9)5-10(12,3-6)4-7;;/h6-9,12H,1-5,11H2;1H;1H2.
What are the key properties of 4-aminoadamantan-1-ol;hydrate;hydrochloride?
4-aminoadamantan-1-ol;hydrate;hydrochloride has a molecular weight of 221.73 g/mol, XLogP of 0.48, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminoadamantan-1-ol;hydrate;hydrochloride is sourced from PubChem (CID 174624676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).