About bis[5-[2-(1,3-oxazol-2-yl)-5-(trifluoromethyl)phenyl]thiophen-3-yl]methanone
bis[5-[2-(1,3-oxazol-2-yl)-5-(trifluoromethyl)phenyl]thiophen-3-yl]methanone (PubChem CID 174624987) has the molecular formula C29H14F6N2O3S2
and a molecular weight of 616.56 g/mol. Its IUPAC name is bis[5-[2-(1,3-oxazol-2-yl)-5-(trifluoromethyl)phenyl]thiophen-3-yl]methanone.
Molecular Properties
| Compound Name | bis[5-[2-(1,3-oxazol-2-yl)-5-(trifluoromethyl)phenyl]thiophen-3-yl]methanone |
| PubChem CID | 174624987 |
| Molecular Formula | C29H14F6N2O3S2 |
| Molecular Weight | 616.56 g/mol |
| Exact Mass | 616.04 |
| IUPAC Name | bis[5-[2-(1,3-oxazol-2-yl)-5-(trifluoromethyl)phenyl]thiophen-3-yl]methanone |
| SMILES | O=C(c1csc(-c2cc(C(F)(F)F)ccc2-c2ncco2)c1)c1csc(-c2cc(C(F)(F)F)ccc2-c2ncco2)c1 |
| InChI | InChI=1S/C29H14F6N2O3S2/c30-28(31,32)17-1-3-19(26-36-5-7-39-26)21(11-17)23-9-15(13-41-23)25(38)16-10-24(42-14-16)22-12-18(29(33,34)35)2-4-20(22)27-37-6-8-40-27/h1-14H |
| InChIKey | MRVCYLBVYFIKCO-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 69.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 616.56 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze bis[5-[2-(1,3-oxazol-2-yl)-5-(trifluoromethyl)phenyl]thiophen-3-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[5-[2-(1,3-oxazol-2-yl)-5-(trifluoromethyl)phenyl]thiophen-3-yl]methanone?
The IUPAC name of bis[5-[2-(1,3-oxazol-2-yl)-5-(trifluoromethyl)phenyl]thiophen-3-yl]methanone (CID 174624987) is bis[5-[2-(1,3-oxazol-2-yl)-5-(trifluoromethyl)phenyl]thiophen-3-yl]methanone.
What is the SMILES notation for bis[5-[2-(1,3-oxazol-2-yl)-5-(trifluoromethyl)phenyl]thiophen-3-yl]methanone?
The canonical SMILES for bis[5-[2-(1,3-oxazol-2-yl)-5-(trifluoromethyl)phenyl]thiophen-3-yl]methanone is O=C(c1csc(-c2cc(C(F)(F)F)ccc2-c2ncco2)c1)c1csc(-c2cc(C(F)(F)F)ccc2-c2ncco2)c1.
What is the InChIKey of bis[5-[2-(1,3-oxazol-2-yl)-5-(trifluoromethyl)phenyl]thiophen-3-yl]methanone?
The InChIKey is MRVCYLBVYFIKCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H14F6N2O3S2/c30-28(31,32)17-1-3-19(26-36-5-7-39-26)21(11-17)23-9-15(13-41-23)25(38)16-10-24(42-14-16)22-12-18(29(33,34)35)2-4-20(22)27-37-6-8-40-27/h1-14H.
What are the key properties of bis[5-[2-(1,3-oxazol-2-yl)-5-(trifluoromethyl)phenyl]thiophen-3-yl]methanone?
bis[5-[2-(1,3-oxazol-2-yl)-5-(trifluoromethyl)phenyl]thiophen-3-yl]methanone has a molecular weight of 616.56 g/mol, XLogP of 9.72, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis[5-[2-(1,3-oxazol-2-yl)-5-(trifluoromethyl)phenyl]thiophen-3-yl]methanone is sourced from PubChem (CID 174624987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).