C12H24O — CID 174625058
(1R,2S,5R)-5-ethyl-5-methyl-2-propan-2-ylcyclohexan-1-ol (PubChem CID 174625058) has the molecular formula C12H24O and a molecular weight of 184.32 g/mol. Its IUPAC name is (1R,2S,5R)-5-ethyl-5-methyl-2-propan-2-ylcyclohexan-1-ol.
| Compound Name | (1R,2S,5R)-5-ethyl-5-methyl-2-propan-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 174625058 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | (1R,2S,5R)-5-ethyl-5-methyl-2-propan-2-ylcyclohexan-1-ol |
| SMILES | CC[C@]1(C)CC[C@@H](C(C)C)[C@H](O)C1 |
| InChI | InChI=1S/C12H24O/c1-5-12(4)7-6-10(9(2)3)11(13)8-12/h9-11,13H,5-8H2,1-4H3/t10-,11+,12+/m0/s1 |
| InChIKey | GWQVHXKMOVMJGN-QJPTWQEYSA-N |
| XLogP | 3.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |