About 2-(1,3-benzoxazol-4-yl)propyl formate
2-(1,3-benzoxazol-4-yl)propyl formate (PubChem CID 174625080) has the molecular formula C11H11NO3
and a molecular weight of 205.21 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-4-yl)propyl formate.
Molecular Properties
| Compound Name | 2-(1,3-benzoxazol-4-yl)propyl formate |
| PubChem CID | 174625080 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 2-(1,3-benzoxazol-4-yl)propyl formate |
| SMILES | CC(COC=O)c1cccc2ocnc12 |
| InChI | InChI=1S/C11H11NO3/c1-8(5-14-7-13)9-3-2-4-10-11(9)12-6-15-10/h2-4,6-8H,5H2,1H3 |
| InChIKey | IJZUFYGLRDOPLM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-benzoxazol-4-yl)propyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzoxazol-4-yl)propyl formate?
The IUPAC name of 2-(1,3-benzoxazol-4-yl)propyl formate (CID 174625080) is 2-(1,3-benzoxazol-4-yl)propyl formate.
What is the SMILES notation for 2-(1,3-benzoxazol-4-yl)propyl formate?
The canonical SMILES for 2-(1,3-benzoxazol-4-yl)propyl formate is CC(COC=O)c1cccc2ocnc12.
What is the InChIKey of 2-(1,3-benzoxazol-4-yl)propyl formate?
The InChIKey is IJZUFYGLRDOPLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3/c1-8(5-14-7-13)9-3-2-4-10-11(9)12-6-15-10/h2-4,6-8H,5H2,1H3.
What are the key properties of 2-(1,3-benzoxazol-4-yl)propyl formate?
2-(1,3-benzoxazol-4-yl)propyl formate has a molecular weight of 205.21 g/mol, XLogP of 2.10, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzoxazol-4-yl)propyl formate is sourced from PubChem (CID 174625080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).