About 4-fluoro-N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylbenzenesulfonamide
4-fluoro-N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylbenzenesulfonamide (PubChem CID 17462518) has the molecular formula C18H18FN3O3S
and a molecular weight of 375.43 g/mol. Its IUPAC name is 4-fluoro-N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylbenzenesulfonamide.
Molecular Properties
| Compound Name | 4-fluoro-N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylbenzenesulfonamide |
| PubChem CID | 17462518 |
| Molecular Formula | C18H18FN3O3S |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 4-fluoro-N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)N(Cc1nnc(-c2ccccc2)o1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H18FN3O3S/c1-13(2)22(26(23,24)16-10-8-15(19)9-11-16)12-17-20-21-18(25-17)14-6-4-3-5-7-14/h3-11,13H,12H2,1-2H3 |
| InChIKey | NHOXMUFTBFFYFM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-fluoro-N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylbenzenesulfonamide?
The IUPAC name of 4-fluoro-N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylbenzenesulfonamide (CID 17462518) is 4-fluoro-N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylbenzenesulfonamide.
What is the SMILES notation for 4-fluoro-N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylbenzenesulfonamide?
The canonical SMILES for 4-fluoro-N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylbenzenesulfonamide is CC(C)N(Cc1nnc(-c2ccccc2)o1)S(=O)(=O)c1ccc(F)cc1.
What is the InChIKey of 4-fluoro-N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylbenzenesulfonamide?
The InChIKey is NHOXMUFTBFFYFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18FN3O3S/c1-13(2)22(26(23,24)16-10-8-15(19)9-11-16)12-17-20-21-18(25-17)14-6-4-3-5-7-14/h3-11,13H,12H2,1-2H3.
What are the key properties of 4-fluoro-N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylbenzenesulfonamide?
4-fluoro-N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylbenzenesulfonamide has a molecular weight of 375.43 g/mol, XLogP of 3.47, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylbenzenesulfonamide is sourced from PubChem (CID 17462518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).