C69H46N4O9S4 — CID 174625594
bis[3,4-bis[1-(benzenesulfonyl)indol-2-yl]phenyl]methanone (PubChem CID 174625594) has the molecular formula C69H46N4O9S4 and a molecular weight of 1203.41 g/mol. Its IUPAC name is bis[3,4-bis[1-(benzenesulfonyl)indol-2-yl]phenyl]methanone.
| Compound Name | bis[3,4-bis[1-(benzenesulfonyl)indol-2-yl]phenyl]methanone |
|---|---|
| PubChem CID | 174625594 |
| Molecular Formula | C69H46N4O9S4 |
| Molecular Weight | 1203.41 g/mol |
| Exact Mass | 1202.21 |
| IUPAC Name | bis[3,4-bis[1-(benzenesulfonyl)indol-2-yl]phenyl]methanone |
| SMILES | O=C(c1ccc(-c2cc3ccccc3n2S(=O)(=O)c2ccccc2)c(-c2cc3ccccc3n2S(=O)(=O)c2ccccc2)c1)c1ccc(-c2cc3ccccc3n2S(=O)(=O)c2ccccc2)c(-c2cc3ccccc3n2S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C69H46N4O9S4/c74-69(51-37-39-57(65-43-47-21-13-17-33-61(47)70(65)83(75,76)53-25-5-1-6-26-53)59(41-51)67-45-49-23-15-19-35-63(49)72(67)85(79,80)55-29-9-3-10-30-55)52-38-40-58(66-44-48-22-14-18-34-62(48)71(66)84(77,78)54-27-7-2-8-28-54)60(42-52)68-46-50-24-16-20-36-64(50)73(68)86(81,82)56-31-11-4-12-32-56/h1-46H |
| InChIKey | UGQWZTZKQCRBOJ-UHFFFAOYSA-N |
| XLogP | 14.35 |
| TPSA | 173.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 86 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1203.41 |
| LogP ≤ 5 | 14.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |