C5H11Br3N3O+ — CID 174625907
diiminoazanium;1,1,3-tribromo-2,2-dimethylpropan-1-ol (PubChem CID 174625907) has the molecular formula C5H11Br3N3O+ and a molecular weight of 368.88 g/mol. Its IUPAC name is diiminoazanium;1,1,3-tribromo-2,2-dimethylpropan-1-ol.
| Compound Name | diiminoazanium;1,1,3-tribromo-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 174625907 |
| Molecular Formula | C5H11Br3N3O+ |
| Molecular Weight | 368.88 g/mol |
| Exact Mass | 365.84 |
| IUPAC Name | diiminoazanium;1,1,3-tribromo-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(CBr)C(O)(Br)Br.N=[N+]=N |
| InChI | InChI=1S/C5H9Br3O.H2N3/c1-4(2,3-6)5(7,8)9;1-3-2/h9H,3H2,1-2H3;1-2H/q;+1 |
| InChIKey | KQRGGEGMINSGAU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.88 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|