About 2-hept-2-en-2-yl-4,5-dihydro-1,3-thiazole
2-hept-2-en-2-yl-4,5-dihydro-1,3-thiazole (PubChem CID 174626693) has the molecular formula C10H17NS
and a molecular weight of 183.32 g/mol. Its IUPAC name is 2-hept-2-en-2-yl-4,5-dihydro-1,3-thiazole.
Molecular Properties
| Compound Name | 2-hept-2-en-2-yl-4,5-dihydro-1,3-thiazole |
| PubChem CID | 174626693 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 2-hept-2-en-2-yl-4,5-dihydro-1,3-thiazole |
| SMILES | CCCCC=C(C)C1=NCCS1 |
| InChI | InChI=1S/C10H17NS/c1-3-4-5-6-9(2)10-11-7-8-12-10/h6H,3-5,7-8H2,1-2H3 |
| InChIKey | UNJFWJVUOBZMJB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hept-2-en-2-yl-4,5-dihydro-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hept-2-en-2-yl-4,5-dihydro-1,3-thiazole?
The IUPAC name of 2-hept-2-en-2-yl-4,5-dihydro-1,3-thiazole (CID 174626693) is 2-hept-2-en-2-yl-4,5-dihydro-1,3-thiazole.
What is the SMILES notation for 2-hept-2-en-2-yl-4,5-dihydro-1,3-thiazole?
The canonical SMILES for 2-hept-2-en-2-yl-4,5-dihydro-1,3-thiazole is CCCCC=C(C)C1=NCCS1.
What is the InChIKey of 2-hept-2-en-2-yl-4,5-dihydro-1,3-thiazole?
The InChIKey is UNJFWJVUOBZMJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NS/c1-3-4-5-6-9(2)10-11-7-8-12-10/h6H,3-5,7-8H2,1-2H3.
What are the key properties of 2-hept-2-en-2-yl-4,5-dihydro-1,3-thiazole?
2-hept-2-en-2-yl-4,5-dihydro-1,3-thiazole has a molecular weight of 183.32 g/mol, XLogP of 3.27, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hept-2-en-2-yl-4,5-dihydro-1,3-thiazole is sourced from PubChem (CID 174626693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).