C11H23NO3 — CID 174626759
2,2-dimethylpropanoic acid;(3R)-3-ethoxypyrrolidine (PubChem CID 174626759) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is 2,2-dimethylpropanoic acid;(3R)-3-ethoxypyrrolidine.
| Compound Name | 2,2-dimethylpropanoic acid;(3R)-3-ethoxypyrrolidine |
|---|---|
| PubChem CID | 174626759 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | 2,2-dimethylpropanoic acid;(3R)-3-ethoxypyrrolidine |
| SMILES | CC(C)(C)C(=O)O.CCO[C@@H]1CCNC1 |
| InChI | InChI=1S/C6H13NO.C5H10O2/c1-2-8-6-3-4-7-5-6;1-5(2,3)4(6)7/h6-7H,2-5H2,1H3;1-3H3,(H,6,7)/t6-;/m1./s1 |
| InChIKey | YRQOYJOOIPRZSQ-FYZOBXCZSA-N |
| XLogP | 1.50 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |