About (4R)-4-benzyl-5,5-dicyclohexyl-4H-1,3-oxazole
(4R)-4-benzyl-5,5-dicyclohexyl-4H-1,3-oxazole (PubChem CID 174626772) has the molecular formula C22H31NO
and a molecular weight of 325.50 g/mol. Its IUPAC name is (4R)-4-benzyl-5,5-dicyclohexyl-4H-1,3-oxazole.
Molecular Properties
| Compound Name | (4R)-4-benzyl-5,5-dicyclohexyl-4H-1,3-oxazole |
| PubChem CID | 174626772 |
| Molecular Formula | C22H31NO |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | (4R)-4-benzyl-5,5-dicyclohexyl-4H-1,3-oxazole |
| SMILES | C1=N[C@H](Cc2ccccc2)C(C2CCCCC2)(C2CCCCC2)O1 |
| InChI | InChI=1S/C22H31NO/c1-4-10-18(11-5-1)16-21-22(24-17-23-21,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1,4-5,10-11,17,19-21H,2-3,6-9,12-16H2/t21-/m1/s1 |
| InChIKey | ZDTUCPQVYLFTCU-OAQYLSRUSA-N |
| XLogP | 5.56 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-4-benzyl-5,5-dicyclohexyl-4H-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-benzyl-5,5-dicyclohexyl-4H-1,3-oxazole?
The IUPAC name of (4R)-4-benzyl-5,5-dicyclohexyl-4H-1,3-oxazole (CID 174626772) is (4R)-4-benzyl-5,5-dicyclohexyl-4H-1,3-oxazole.
What is the SMILES notation for (4R)-4-benzyl-5,5-dicyclohexyl-4H-1,3-oxazole?
The canonical SMILES for (4R)-4-benzyl-5,5-dicyclohexyl-4H-1,3-oxazole is C1=N[C@H](Cc2ccccc2)C(C2CCCCC2)(C2CCCCC2)O1.
What is the InChIKey of (4R)-4-benzyl-5,5-dicyclohexyl-4H-1,3-oxazole?
The InChIKey is ZDTUCPQVYLFTCU-OAQYLSRUSA-N. The full InChI is InChI=1S/C22H31NO/c1-4-10-18(11-5-1)16-21-22(24-17-23-21,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1,4-5,10-11,17,19-21H,2-3,6-9,12-16H2/t21-/m1/s1.
What are the key properties of (4R)-4-benzyl-5,5-dicyclohexyl-4H-1,3-oxazole?
(4R)-4-benzyl-5,5-dicyclohexyl-4H-1,3-oxazole has a molecular weight of 325.50 g/mol, XLogP of 5.56, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-benzyl-5,5-dicyclohexyl-4H-1,3-oxazole is sourced from PubChem (CID 174626772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).