C12H17N2O3S- — CID 174627257
[4-(3-methoxyphenyl)piperazin-1-yl]methanesulfinate (PubChem CID 174627257) has the molecular formula C12H17N2O3S- and a molecular weight of 269.35 g/mol. Its IUPAC name is [4-(3-methoxyphenyl)piperazin-1-yl]methanesulfinate.
| Compound Name | [4-(3-methoxyphenyl)piperazin-1-yl]methanesulfinate |
|---|---|
| PubChem CID | 174627257 |
| Molecular Formula | C12H17N2O3S- |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | [4-(3-methoxyphenyl)piperazin-1-yl]methanesulfinate |
| SMILES | COc1cccc(N2CCN(CS(=O)[O-])CC2)c1 |
| InChI | InChI=1S/C12H18N2O3S/c1-17-12-4-2-3-11(9-12)14-7-5-13(6-8-14)10-18(15)16/h2-4,9H,5-8,10H2,1H3,(H,15,16)/p-1 |
| InChIKey | XFUWJGGPSMZQBI-UHFFFAOYSA-M |
| XLogP | 0.65 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|