C19H26N2 — CID 174628687
5-(2-phenylethyl)-N,N-dipropylpyridin-2-amine (PubChem CID 174628687) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 5-(2-phenylethyl)-N,N-dipropylpyridin-2-amine.
| Compound Name | 5-(2-phenylethyl)-N,N-dipropylpyridin-2-amine |
|---|---|
| PubChem CID | 174628687 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 5-(2-phenylethyl)-N,N-dipropylpyridin-2-amine |
| SMILES | CCCN(CCC)c1ccc(CCc2ccccc2)cn1 |
| InChI | InChI=1S/C19H26N2/c1-3-14-21(15-4-2)19-13-12-18(16-20-19)11-10-17-8-6-5-7-9-17/h5-9,12-13,16H,3-4,10-11,14-15H2,1-2H3 |
| InChIKey | VUFUERUQWIWHSB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |