C11H11BrO2 — CID 174628781
7-bromo-5-hydroxy-1,2,3,4-tetrahydronaphthalene-1-carbaldehyde (PubChem CID 174628781) has the molecular formula C11H11BrO2 and a molecular weight of 255.11 g/mol. Its IUPAC name is 7-bromo-5-hydroxy-1,2,3,4-tetrahydronaphthalene-1-carbaldehyde.
| Compound Name | 7-bromo-5-hydroxy-1,2,3,4-tetrahydronaphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 174628781 |
| Molecular Formula | C11H11BrO2 |
| Molecular Weight | 255.11 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | 7-bromo-5-hydroxy-1,2,3,4-tetrahydronaphthalene-1-carbaldehyde |
| SMILES | O=CC1CCCc2c(O)cc(Br)cc21 |
| InChI | InChI=1S/C11H11BrO2/c12-8-4-10-7(6-13)2-1-3-9(10)11(14)5-8/h4-7,14H,1-3H2 |
| InChIKey | YFAPVIOWFQZUMJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.11 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|