C12H18AuBr6 — CID 174628805
gold;1,1,2,2,3,3-hexabromocyclododecane (PubChem CID 174628805) has the molecular formula C12H18AuBr6 and a molecular weight of 838.67 g/mol. Its IUPAC name is gold;1,1,2,2,3,3-hexabromocyclododecane.
| Compound Name | gold;1,1,2,2,3,3-hexabromocyclododecane |
|---|---|
| PubChem CID | 174628805 |
| Molecular Formula | C12H18AuBr6 |
| Molecular Weight | 838.67 g/mol |
| Exact Mass | 832.62 |
| IUPAC Name | gold;1,1,2,2,3,3-hexabromocyclododecane |
| SMILES | BrC1(Br)CCCCCCCCCC(Br)(Br)C1(Br)Br.[Au] |
| InChI | InChI=1S/C12H18Br6.Au/c13-10(14)8-6-4-2-1-3-5-7-9-11(15,16)12(10,17)18;/h1-9H2; |
| InChIKey | UDYZQZVUNCYUBB-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.67 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|