About tert-butyl N-methyl-N-[2-(methylamino)ethyl]carbamate;2,2,2-trifluoroacetic acid
tert-butyl N-methyl-N-[2-(methylamino)ethyl]carbamate;2,2,2-trifluoroacetic acid (PubChem CID 174629010) has the molecular formula C11H21F3N2O4
and a molecular weight of 302.29 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[2-(methylamino)ethyl]carbamate;2,2,2-trifluoroacetic acid.
Molecular Properties
| Compound Name | tert-butyl N-methyl-N-[2-(methylamino)ethyl]carbamate;2,2,2-trifluoroacetic acid |
| PubChem CID | 174629010 |
| Molecular Formula | C11H21F3N2O4 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | tert-butyl N-methyl-N-[2-(methylamino)ethyl]carbamate;2,2,2-trifluoroacetic acid |
| SMILES | CNCCN(C)C(=O)OC(C)(C)C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C9H20N2O2.C2HF3O2/c1-9(2,3)13-8(12)11(5)7-6-10-4;3-2(4,5)1(6)7/h10H,6-7H2,1-5H3;(H,6,7) |
| InChIKey | UJSIMRKECMRRNJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-methyl-N-[2-(methylamino)ethyl]carbamate;2,2,2-trifluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-methyl-N-[2-(methylamino)ethyl]carbamate;2,2,2-trifluoroacetic acid?
The IUPAC name of tert-butyl N-methyl-N-[2-(methylamino)ethyl]carbamate;2,2,2-trifluoroacetic acid (CID 174629010) is tert-butyl N-methyl-N-[2-(methylamino)ethyl]carbamate;2,2,2-trifluoroacetic acid.
What is the SMILES notation for tert-butyl N-methyl-N-[2-(methylamino)ethyl]carbamate;2,2,2-trifluoroacetic acid?
The canonical SMILES for tert-butyl N-methyl-N-[2-(methylamino)ethyl]carbamate;2,2,2-trifluoroacetic acid is CNCCN(C)C(=O)OC(C)(C)C.O=C(O)C(F)(F)F.
What is the InChIKey of tert-butyl N-methyl-N-[2-(methylamino)ethyl]carbamate;2,2,2-trifluoroacetic acid?
The InChIKey is UJSIMRKECMRRNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O2.C2HF3O2/c1-9(2,3)13-8(12)11(5)7-6-10-4;3-2(4,5)1(6)7/h10H,6-7H2,1-5H3;(H,6,7).
What are the key properties of tert-butyl N-methyl-N-[2-(methylamino)ethyl]carbamate;2,2,2-trifluoroacetic acid?
tert-butyl N-methyl-N-[2-(methylamino)ethyl]carbamate;2,2,2-trifluoroacetic acid has a molecular weight of 302.29 g/mol, XLogP of 1.71, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-methyl-N-[2-(methylamino)ethyl]carbamate;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 174629010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).