C18H27Cl2N5O — CID 174629242
N-[4-[(3R)-3-aminopiperidin-1-yl]-5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl]hexanamide;hydrochloride (PubChem CID 174629242) has the molecular formula C18H27Cl2N5O and a molecular weight of 400.35 g/mol. Its IUPAC name is N-[4-[(3R)-3-aminopiperidin-1-yl]-5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl]hexanamide;hydrochloride.
| Compound Name | N-[4-[(3R)-3-aminopiperidin-1-yl]-5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl]hexanamide;hydrochloride |
|---|---|
| PubChem CID | 174629242 |
| Molecular Formula | C18H27Cl2N5O |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | N-[4-[(3R)-3-aminopiperidin-1-yl]-5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl]hexanamide;hydrochloride |
| SMILES | CCCCCC(=O)Nc1c[nH]c2ncc(Cl)c(N3CCC[C@@H](N)C3)c12.Cl |
| InChI | InChI=1S/C18H26ClN5O.ClH/c1-2-3-4-7-15(25)23-14-10-22-18-16(14)17(13(19)9-21-18)24-8-5-6-12(20)11-24;/h9-10,12H,2-8,11,20H2,1H3,(H,21,22)(H,23,25);1H/t12-;/m1./s1 |
| InChIKey | BWDVBEQGVDXBCX-UTONKHPSSA-N |
| XLogP | 4.08 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|