About methyl 4-[(3R)-3-[1-(2,2-dimethylpropanoyloxy)piperidin-4-yl]butoxy]-2-methylbenzoate
methyl 4-[(3R)-3-[1-(2,2-dimethylpropanoyloxy)piperidin-4-yl]butoxy]-2-methylbenzoate (PubChem CID 174629704) has the molecular formula C23H35NO5
and a molecular weight of 405.54 g/mol. Its IUPAC name is methyl 4-[(3R)-3-[1-(2,2-dimethylpropanoyloxy)piperidin-4-yl]butoxy]-2-methylbenzoate.
Molecular Properties
| Compound Name | methyl 4-[(3R)-3-[1-(2,2-dimethylpropanoyloxy)piperidin-4-yl]butoxy]-2-methylbenzoate |
| PubChem CID | 174629704 |
| Molecular Formula | C23H35NO5 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | methyl 4-[(3R)-3-[1-(2,2-dimethylpropanoyloxy)piperidin-4-yl]butoxy]-2-methylbenzoate |
| SMILES | COC(=O)c1ccc(OCC[C@@H](C)C2CCN(OC(=O)C(C)(C)C)CC2)cc1C |
| InChI | InChI=1S/C23H35NO5/c1-16(18-9-12-24(13-10-18)29-22(26)23(3,4)5)11-14-28-19-7-8-20(17(2)15-19)21(25)27-6/h7-8,15-16,18H,9-14H2,1-6H3/t16-/m1/s1 |
| InChIKey | YMPDYIWPPKNYBQ-MRXNPFEDSA-N |
| XLogP | 4.40 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-[(3R)-3-[1-(2,2-dimethylpropanoyloxy)piperidin-4-yl]butoxy]-2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(3R)-3-[1-(2,2-dimethylpropanoyloxy)piperidin-4-yl]butoxy]-2-methylbenzoate?
The IUPAC name of methyl 4-[(3R)-3-[1-(2,2-dimethylpropanoyloxy)piperidin-4-yl]butoxy]-2-methylbenzoate (CID 174629704) is methyl 4-[(3R)-3-[1-(2,2-dimethylpropanoyloxy)piperidin-4-yl]butoxy]-2-methylbenzoate.
What is the SMILES notation for methyl 4-[(3R)-3-[1-(2,2-dimethylpropanoyloxy)piperidin-4-yl]butoxy]-2-methylbenzoate?
The canonical SMILES for methyl 4-[(3R)-3-[1-(2,2-dimethylpropanoyloxy)piperidin-4-yl]butoxy]-2-methylbenzoate is COC(=O)c1ccc(OCC[C@@H](C)C2CCN(OC(=O)C(C)(C)C)CC2)cc1C.
What is the InChIKey of methyl 4-[(3R)-3-[1-(2,2-dimethylpropanoyloxy)piperidin-4-yl]butoxy]-2-methylbenzoate?
The InChIKey is YMPDYIWPPKNYBQ-MRXNPFEDSA-N. The full InChI is InChI=1S/C23H35NO5/c1-16(18-9-12-24(13-10-18)29-22(26)23(3,4)5)11-14-28-19-7-8-20(17(2)15-19)21(25)27-6/h7-8,15-16,18H,9-14H2,1-6H3/t16-/m1/s1.
What are the key properties of methyl 4-[(3R)-3-[1-(2,2-dimethylpropanoyloxy)piperidin-4-yl]butoxy]-2-methylbenzoate?
methyl 4-[(3R)-3-[1-(2,2-dimethylpropanoyloxy)piperidin-4-yl]butoxy]-2-methylbenzoate has a molecular weight of 405.54 g/mol, XLogP of 4.40, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(3R)-3-[1-(2,2-dimethylpropanoyloxy)piperidin-4-yl]butoxy]-2-methylbenzoate is sourced from PubChem (CID 174629704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).