C17H29FO4 — CID 174629904
tert-butyl 2-(2,2-dimethyl-1,3-dioxan-4-yl)-2-fluorohept-6-enoate (PubChem CID 174629904) has the molecular formula C17H29FO4 and a molecular weight of 316.41 g/mol. Its IUPAC name is tert-butyl 2-(2,2-dimethyl-1,3-dioxan-4-yl)-2-fluorohept-6-enoate.
| Compound Name | tert-butyl 2-(2,2-dimethyl-1,3-dioxan-4-yl)-2-fluorohept-6-enoate |
|---|---|
| PubChem CID | 174629904 |
| Molecular Formula | C17H29FO4 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | tert-butyl 2-(2,2-dimethyl-1,3-dioxan-4-yl)-2-fluorohept-6-enoate |
| SMILES | C=CCCCC(F)(C(=O)OC(C)(C)C)C1CCOC(C)(C)O1 |
| InChI | InChI=1S/C17H29FO4/c1-7-8-9-11-17(18,14(19)22-15(2,3)4)13-10-12-20-16(5,6)21-13/h7,13H,1,8-12H2,2-6H3 |
| InChIKey | VFSLJFFXKRIJEC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|