About [2-[6-(cyclopropylsulfonylamino)-3-phenylindazol-1-yl]-2-(1,3-thiazol-4-yl)ethyl] formate
[2-[6-(cyclopropylsulfonylamino)-3-phenylindazol-1-yl]-2-(1,3-thiazol-4-yl)ethyl] formate (PubChem CID 174630410) has the molecular formula C22H20N4O4S2
and a molecular weight of 468.56 g/mol. Its IUPAC name is [2-[6-(cyclopropylsulfonylamino)-3-phenylindazol-1-yl]-2-(1,3-thiazol-4-yl)ethyl] formate.
Molecular Properties
| Compound Name | [2-[6-(cyclopropylsulfonylamino)-3-phenylindazol-1-yl]-2-(1,3-thiazol-4-yl)ethyl] formate |
| PubChem CID | 174630410 |
| Molecular Formula | C22H20N4O4S2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | [2-[6-(cyclopropylsulfonylamino)-3-phenylindazol-1-yl]-2-(1,3-thiazol-4-yl)ethyl] formate |
| SMILES | O=COCC(c1cscn1)n1nc(-c2ccccc2)c2ccc(NS(=O)(=O)C3CC3)cc21 |
| InChI | InChI=1S/C22H20N4O4S2/c27-14-30-11-21(19-12-31-13-23-19)26-20-10-16(25-32(28,29)17-7-8-17)6-9-18(20)22(24-26)15-4-2-1-3-5-15/h1-6,9-10,12-14,17,21,25H,7-8,11H2 |
| InChIKey | UIKBUAXLZUWUQS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [2-[6-(cyclopropylsulfonylamino)-3-phenylindazol-1-yl]-2-(1,3-thiazol-4-yl)ethyl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[6-(cyclopropylsulfonylamino)-3-phenylindazol-1-yl]-2-(1,3-thiazol-4-yl)ethyl] formate?
The IUPAC name of [2-[6-(cyclopropylsulfonylamino)-3-phenylindazol-1-yl]-2-(1,3-thiazol-4-yl)ethyl] formate (CID 174630410) is [2-[6-(cyclopropylsulfonylamino)-3-phenylindazol-1-yl]-2-(1,3-thiazol-4-yl)ethyl] formate.
What is the SMILES notation for [2-[6-(cyclopropylsulfonylamino)-3-phenylindazol-1-yl]-2-(1,3-thiazol-4-yl)ethyl] formate?
The canonical SMILES for [2-[6-(cyclopropylsulfonylamino)-3-phenylindazol-1-yl]-2-(1,3-thiazol-4-yl)ethyl] formate is O=COCC(c1cscn1)n1nc(-c2ccccc2)c2ccc(NS(=O)(=O)C3CC3)cc21.
What is the InChIKey of [2-[6-(cyclopropylsulfonylamino)-3-phenylindazol-1-yl]-2-(1,3-thiazol-4-yl)ethyl] formate?
The InChIKey is UIKBUAXLZUWUQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N4O4S2/c27-14-30-11-21(19-12-31-13-23-19)26-20-10-16(25-32(28,29)17-7-8-17)6-9-18(20)22(24-26)15-4-2-1-3-5-15/h1-6,9-10,12-14,17,21,25H,7-8,11H2.
What are the key properties of [2-[6-(cyclopropylsulfonylamino)-3-phenylindazol-1-yl]-2-(1,3-thiazol-4-yl)ethyl] formate?
[2-[6-(cyclopropylsulfonylamino)-3-phenylindazol-1-yl]-2-(1,3-thiazol-4-yl)ethyl] formate has a molecular weight of 468.56 g/mol, XLogP of 3.83, 9 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[6-(cyclopropylsulfonylamino)-3-phenylindazol-1-yl]-2-(1,3-thiazol-4-yl)ethyl] formate is sourced from PubChem (CID 174630410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).