About 3-[(3-bromophenyl)methyl]-1,2-dihydrobenzimidazole
3-[(3-bromophenyl)methyl]-1,2-dihydrobenzimidazole (PubChem CID 174630885) has the molecular formula C14H13BrN2
and a molecular weight of 289.18 g/mol. Its IUPAC name is 3-[(3-bromophenyl)methyl]-1,2-dihydrobenzimidazole.
Molecular Properties
| Compound Name | 3-[(3-bromophenyl)methyl]-1,2-dihydrobenzimidazole |
| PubChem CID | 174630885 |
| Molecular Formula | C14H13BrN2 |
| Molecular Weight | 289.18 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 3-[(3-bromophenyl)methyl]-1,2-dihydrobenzimidazole |
| SMILES | Brc1cccc(CN2CNc3ccccc32)c1 |
| InChI | InChI=1S/C14H13BrN2/c15-12-5-3-4-11(8-12)9-17-10-16-13-6-1-2-7-14(13)17/h1-8,16H,9-10H2 |
| InChIKey | MMDPSQLPCWGKDT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.18 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(3-bromophenyl)methyl]-1,2-dihydrobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-bromophenyl)methyl]-1,2-dihydrobenzimidazole?
The IUPAC name of 3-[(3-bromophenyl)methyl]-1,2-dihydrobenzimidazole (CID 174630885) is 3-[(3-bromophenyl)methyl]-1,2-dihydrobenzimidazole.
What is the SMILES notation for 3-[(3-bromophenyl)methyl]-1,2-dihydrobenzimidazole?
The canonical SMILES for 3-[(3-bromophenyl)methyl]-1,2-dihydrobenzimidazole is Brc1cccc(CN2CNc3ccccc32)c1.
What is the InChIKey of 3-[(3-bromophenyl)methyl]-1,2-dihydrobenzimidazole?
The InChIKey is MMDPSQLPCWGKDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13BrN2/c15-12-5-3-4-11(8-12)9-17-10-16-13-6-1-2-7-14(13)17/h1-8,16H,9-10H2.
What are the key properties of 3-[(3-bromophenyl)methyl]-1,2-dihydrobenzimidazole?
3-[(3-bromophenyl)methyl]-1,2-dihydrobenzimidazole has a molecular weight of 289.18 g/mol, XLogP of 3.84, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-bromophenyl)methyl]-1,2-dihydrobenzimidazole is sourced from PubChem (CID 174630885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).