1,3-dimethylimidazolidin-2-one;trimethyl phosphite

C8H19N2O4P — CID 174631101

IUPAC1,3-dimethylimidazolidin-2-one;trimethyl phosphite
SMILESCN1CCN(C)C1=O.COP(OC)OC
InChIInChI=1S/C5H10N2O.C3H9O3P/c1-6-3-4-7(2)5(6)8;1-4-7(5-2)6-3/h3-4H2,1-2H3;1-3H3
InChIKeyHINJPNYGOXQBHN-UHFFFAOYSA-N
MW238.22 g/mol
LogP1.14
Rot. Bonds3

About 1,3-dimethylimidazolidin-2-one;trimethyl phosphite

1,3-dimethylimidazolidin-2-one;trimethyl phosphite (PubChem CID 174631101) has the molecular formula C8H19N2O4P and a molecular weight of 238.22 g/mol. Its IUPAC name is 1,3-dimethylimidazolidin-2-one;trimethyl phosphite.

Molecular Properties

Compound Name1,3-dimethylimidazolidin-2-one;trimethyl phosphite
PubChem CID174631101
Molecular FormulaC8H19N2O4P
Molecular Weight238.22 g/mol
Exact Mass238.11
IUPAC Name1,3-dimethylimidazolidin-2-one;trimethyl phosphite
SMILESCN1CCN(C)C1=O.COP(OC)OC
InChIInChI=1S/C5H10N2O.C3H9O3P/c1-6-3-4-7(2)5(6)8;1-4-7(5-2)6-3/h3-4H2,1-2H3;1-3H3
InChIKeyHINJPNYGOXQBHN-UHFFFAOYSA-N
XLogP1.14
TPSA51.24 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.22
LogP ≤ 51.14
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 1,3-dimethylimidazolidin-2-one;trimethyl phosphite with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-dimethylimidazolidin-2-one;trimethyl phosphite?
The IUPAC name of 1,3-dimethylimidazolidin-2-one;trimethyl phosphite (CID 174631101) is 1,3-dimethylimidazolidin-2-one;trimethyl phosphite.
What is the SMILES notation for 1,3-dimethylimidazolidin-2-one;trimethyl phosphite?
The canonical SMILES for 1,3-dimethylimidazolidin-2-one;trimethyl phosphite is CN1CCN(C)C1=O.COP(OC)OC.
What is the InChIKey of 1,3-dimethylimidazolidin-2-one;trimethyl phosphite?
The InChIKey is HINJPNYGOXQBHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O.C3H9O3P/c1-6-3-4-7(2)5(6)8;1-4-7(5-2)6-3/h3-4H2,1-2H3;1-3H3.
What are the key properties of 1,3-dimethylimidazolidin-2-one;trimethyl phosphite?
1,3-dimethylimidazolidin-2-one;trimethyl phosphite has a molecular weight of 238.22 g/mol, XLogP of 1.14, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylimidazolidin-2-one;trimethyl phosphite is sourced from PubChem (CID 174631101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).