About 1,3-dimethylimidazolidin-2-one;trimethyl phosphite
1,3-dimethylimidazolidin-2-one;trimethyl phosphite (PubChem CID 174631101) has the molecular formula C8H19N2O4P
and a molecular weight of 238.22 g/mol. Its IUPAC name is 1,3-dimethylimidazolidin-2-one;trimethyl phosphite.
Molecular Properties
| Compound Name | 1,3-dimethylimidazolidin-2-one;trimethyl phosphite |
| PubChem CID | 174631101 |
| Molecular Formula | C8H19N2O4P |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 1,3-dimethylimidazolidin-2-one;trimethyl phosphite |
| SMILES | CN1CCN(C)C1=O.COP(OC)OC |
| InChI | InChI=1S/C5H10N2O.C3H9O3P/c1-6-3-4-7(2)5(6)8;1-4-7(5-2)6-3/h3-4H2,1-2H3;1-3H3 |
| InChIKey | HINJPNYGOXQBHN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethylimidazolidin-2-one;trimethyl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylimidazolidin-2-one;trimethyl phosphite?
The IUPAC name of 1,3-dimethylimidazolidin-2-one;trimethyl phosphite (CID 174631101) is 1,3-dimethylimidazolidin-2-one;trimethyl phosphite.
What is the SMILES notation for 1,3-dimethylimidazolidin-2-one;trimethyl phosphite?
The canonical SMILES for 1,3-dimethylimidazolidin-2-one;trimethyl phosphite is CN1CCN(C)C1=O.COP(OC)OC.
What is the InChIKey of 1,3-dimethylimidazolidin-2-one;trimethyl phosphite?
The InChIKey is HINJPNYGOXQBHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O.C3H9O3P/c1-6-3-4-7(2)5(6)8;1-4-7(5-2)6-3/h3-4H2,1-2H3;1-3H3.
What are the key properties of 1,3-dimethylimidazolidin-2-one;trimethyl phosphite?
1,3-dimethylimidazolidin-2-one;trimethyl phosphite has a molecular weight of 238.22 g/mol, XLogP of 1.14, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylimidazolidin-2-one;trimethyl phosphite is sourced from PubChem (CID 174631101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).