About [(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] 5-methylpyridine-3-carboxylate
[(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] 5-methylpyridine-3-carboxylate (PubChem CID 174631131) has the molecular formula C12H15NO5
and a molecular weight of 253.25 g/mol. Its IUPAC name is [(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] 5-methylpyridine-3-carboxylate.
Molecular Properties
| Compound Name | [(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] 5-methylpyridine-3-carboxylate |
| PubChem CID | 174631131 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | [(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] 5-methylpyridine-3-carboxylate |
| SMILES | Cc1cncc(C(=O)OC2C[C@H](O)[C@@H](CO)O2)c1 |
| InChI | InChI=1S/C12H15NO5/c1-7-2-8(5-13-4-7)12(16)18-11-3-9(15)10(6-14)17-11/h2,4-5,9-11,14-15H,3,6H2,1H3/t9-,10+,11?/m0/s1 |
| InChIKey | KOXKQXFRHMHSJH-MTULOOOASA-N |
| XLogP | 0.02 |
| TPSA | 88.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] 5-methylpyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] 5-methylpyridine-3-carboxylate?
The IUPAC name of [(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] 5-methylpyridine-3-carboxylate (CID 174631131) is [(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] 5-methylpyridine-3-carboxylate.
What is the SMILES notation for [(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] 5-methylpyridine-3-carboxylate?
The canonical SMILES for [(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] 5-methylpyridine-3-carboxylate is Cc1cncc(C(=O)OC2C[C@H](O)[C@@H](CO)O2)c1.
What is the InChIKey of [(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] 5-methylpyridine-3-carboxylate?
The InChIKey is KOXKQXFRHMHSJH-MTULOOOASA-N. The full InChI is InChI=1S/C12H15NO5/c1-7-2-8(5-13-4-7)12(16)18-11-3-9(15)10(6-14)17-11/h2,4-5,9-11,14-15H,3,6H2,1H3/t9-,10+,11?/m0/s1.
What are the key properties of [(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] 5-methylpyridine-3-carboxylate?
[(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] 5-methylpyridine-3-carboxylate has a molecular weight of 253.25 g/mol, XLogP of 0.02, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] 5-methylpyridine-3-carboxylate is sourced from PubChem (CID 174631131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).