About 2-but-3-enyldecanoic acid;sulfane
2-but-3-enyldecanoic acid;sulfane (PubChem CID 174631215) has the molecular formula C14H28O2S
and a molecular weight of 260.44 g/mol. Its IUPAC name is 2-but-3-enyldecanoic acid;sulfane.
Molecular Properties
| Compound Name | 2-but-3-enyldecanoic acid;sulfane |
| PubChem CID | 174631215 |
| Molecular Formula | C14H28O2S |
| Molecular Weight | 260.44 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 2-but-3-enyldecanoic acid;sulfane |
| SMILES | C=CCCC(CCCCCCCC)C(=O)O.S |
| InChI | InChI=1S/C14H26O2.H2S/c1-3-5-7-8-9-10-12-13(14(15)16)11-6-4-2;/h4,13H,2-3,5-12H2,1H3,(H,15,16);1H2 |
| InChIKey | PXQKVLKEJHPRNE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-but-3-enyldecanoic acid;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-but-3-enyldecanoic acid;sulfane?
The IUPAC name of 2-but-3-enyldecanoic acid;sulfane (CID 174631215) is 2-but-3-enyldecanoic acid;sulfane.
What is the SMILES notation for 2-but-3-enyldecanoic acid;sulfane?
The canonical SMILES for 2-but-3-enyldecanoic acid;sulfane is C=CCCC(CCCCCCCC)C(=O)O.S.
What is the InChIKey of 2-but-3-enyldecanoic acid;sulfane?
The InChIKey is PXQKVLKEJHPRNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O2.H2S/c1-3-5-7-8-9-10-12-13(14(15)16)11-6-4-2;/h4,13H,2-3,5-12H2,1H3,(H,15,16);1H2.
What are the key properties of 2-but-3-enyldecanoic acid;sulfane?
2-but-3-enyldecanoic acid;sulfane has a molecular weight of 260.44 g/mol, XLogP of 4.52, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-but-3-enyldecanoic acid;sulfane is sourced from PubChem (CID 174631215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).