C18H29NO3 — CID 174631529
tert-butyl formate;(3R)-3-[(2-methylphenoxy)methyl]piperidine (PubChem CID 174631529) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is tert-butyl formate;(3R)-3-[(2-methylphenoxy)methyl]piperidine.
| Compound Name | tert-butyl formate;(3R)-3-[(2-methylphenoxy)methyl]piperidine |
|---|---|
| PubChem CID | 174631529 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | tert-butyl formate;(3R)-3-[(2-methylphenoxy)methyl]piperidine |
| SMILES | CC(C)(C)OC=O.Cc1ccccc1OC[C@@H]1CCCNC1 |
| InChI | InChI=1S/C13H19NO.C5H10O2/c1-11-5-2-3-7-13(11)15-10-12-6-4-8-14-9-12;1-5(2,3)7-4-6/h2-3,5,7,12,14H,4,6,8-10H2,1H3;4H,1-3H3/t12-;/m1./s1 |
| InChIKey | BNDDEIZMZCIDCF-UTONKHPSSA-N |
| XLogP | 3.33 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|